C44H50N2O8 — CID 68596603
bis[(3S)-3-[(2-ethoxyphenoxy)-phenylmethyl]piperidin-1-yl] (E)-but-2-enedioate (PubChem CID 68596603) has the molecular formula C44H50N2O8 and a molecular weight of 734.89 g/mol. Its IUPAC name is bis[(3S)-3-[(2-ethoxyphenoxy)-phenylmethyl]piperidin-1-yl] (E)-but-2-enedioate.
| Compound Name | bis[(3S)-3-[(2-ethoxyphenoxy)-phenylmethyl]piperidin-1-yl] (E)-but-2-enedioate |
|---|---|
| PubChem CID | 68596603 |
| Molecular Formula | C44H50N2O8 |
| Molecular Weight | 734.89 g/mol |
| Exact Mass | 734.36 |
| IUPAC Name | bis[(3S)-3-[(2-ethoxyphenoxy)-phenylmethyl]piperidin-1-yl] (E)-but-2-enedioate |
| SMILES | CCOc1ccccc1OC(c1ccccc1)[C@H]1CCCN(OC(=O)/C=C/C(=O)ON2CCC[C@H](C(Oc3ccccc3OCC)c3ccccc3)C2)C1 |
| InChI | InChI=1S/C44H50N2O8/c1-3-49-37-23-11-13-25-39(37)51-43(33-17-7-5-8-18-33)35-21-15-29-45(31-35)53-41(47)27-28-42(48)54-46-30-16-22-36(32-46)44(34-19-9-6-10-20-34)52-40-26-14-12-24-38(40)50-4-2/h5-14,17-20,23-28,35-36,43-44H,3-4,15-16,21-22,29-32H2,1-2H3/b28-27+/t35-,36-,43?,44?/m0/s1 |
| InChIKey | AJTZFZXEAVXUQJ-YBULDUGYSA-N |
| XLogP | 8.32 |
| TPSA | 96.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.89 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|