C27H32N4O3 — CID 156541554
N-[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]-2-methyl-2-phenylpropanamide (PubChem CID 156541554) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is N-[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]-2-methyl-2-phenylpropanamide.
| Compound Name | N-[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]-2-methyl-2-phenylpropanamide |
|---|---|
| PubChem CID | 156541554 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[6-[3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]-2-methyl-2-phenylpropanamide |
| SMILES | CCOc1ccccc1OC1CCCN(c2cncc(NC(=O)C(C)(C)c3ccccc3)n2)C1 |
| InChI | InChI=1S/C27H32N4O3/c1-4-33-22-14-8-9-15-23(22)34-21-13-10-16-31(19-21)25-18-28-17-24(29-25)30-26(32)27(2,3)20-11-6-5-7-12-20/h5-9,11-12,14-15,17-18,21H,4,10,13,16,19H2,1-3H3,(H,29,30,32) |
| InChIKey | DOKPWPRKBWNQRH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |