C24H30N4O5 — CID 175808002
1-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]cyclopentane-1-carboxylic acid (PubChem CID 175808002) has the molecular formula C24H30N4O5 and a molecular weight of 454.53 g/mol. Its IUPAC name is 1-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]cyclopentane-1-carboxylic acid.
| Compound Name | 1-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 175808002 |
| Molecular Formula | C24H30N4O5 |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | 1-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]cyclopentane-1-carboxylic acid |
| SMILES | CCOc1ccccc1O[C@@H]1CCCN(c2cncc(NC(=O)C3(C(=O)O)CCCC3)n2)C1 |
| InChI | InChI=1S/C24H30N4O5/c1-2-32-18-9-3-4-10-19(18)33-17-8-7-13-28(16-17)21-15-25-14-20(26-21)27-22(29)24(23(30)31)11-5-6-12-24/h3-4,9-10,14-15,17H,2,5-8,11-13,16H2,1H3,(H,30,31)(H,26,27,29)/t17-/m1/s1 |
| InChIKey | XQHGHZQWAMIMIU-QGZVFWFLSA-N |
| XLogP | 3.51 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|