C29H34N4O6 — CID 156541437
4-[4-[2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-2-oxoethyl]phenoxy]butanoic acid (PubChem CID 156541437) has the molecular formula C29H34N4O6 and a molecular weight of 534.61 g/mol. Its IUPAC name is 4-[4-[2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-2-oxoethyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-2-oxoethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 156541437 |
| Molecular Formula | C29H34N4O6 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.25 |
| IUPAC Name | 4-[4-[2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]amino]-2-oxoethyl]phenoxy]butanoic acid |
| SMILES | CCOc1ccccc1O[C@@H]1CCCN(c2cncc(NC(=O)Cc3ccc(OCCCC(=O)O)cc3)n2)C1 |
| InChI | InChI=1S/C29H34N4O6/c1-2-37-24-8-3-4-9-25(24)39-23-7-5-15-33(20-23)27-19-30-18-26(31-27)32-28(34)17-21-11-13-22(14-12-21)38-16-6-10-29(35)36/h3-4,8-9,11-14,18-19,23H,2,5-7,10,15-17,20H2,1H3,(H,35,36)(H,31,32,34)/t23-/m1/s1 |
| InChIKey | JNJLGGYABVTHAP-HSZRJFAPSA-N |
| XLogP | 4.35 |
| TPSA | 123.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|