C25H26N4O5 — CID 156541338
2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]benzoic acid (PubChem CID 156541338) has the molecular formula C25H26N4O5 and a molecular weight of 462.51 g/mol. Its IUPAC name is 2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]benzoic acid.
| Compound Name | 2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 156541338 |
| Molecular Formula | C25H26N4O5 |
| Molecular Weight | 462.51 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 2-[[6-[(3R)-3-(2-ethoxyphenoxy)piperidin-1-yl]pyrazin-2-yl]carbamoyl]benzoic acid |
| SMILES | CCOc1ccccc1O[C@@H]1CCCN(c2cncc(NC(=O)c3ccccc3C(=O)O)n2)C1 |
| InChI | InChI=1S/C25H26N4O5/c1-2-33-20-11-5-6-12-21(20)34-17-8-7-13-29(16-17)23-15-26-14-22(27-23)28-24(30)18-9-3-4-10-19(18)25(31)32/h3-6,9-12,14-15,17H,2,7-8,13,16H2,1H3,(H,31,32)(H,27,28,30)/t17-/m1/s1 |
| InChIKey | BVBHAAINNNOVDQ-QGZVFWFLSA-N |
| XLogP | 3.87 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |