C17H31N3O2 — CID 56912020
1-[(1R,5S)-6-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]-3-azabicyclo[3.1.0]hexan-3-yl]ethanone (PubChem CID 56912020) has the molecular formula C17H31N3O2 and a molecular weight of 309.45 g/mol. Its IUPAC name is 1-[(1R,5S)-6-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]-3-azabicyclo[3.1.0]hexan-3-yl]ethanone.
| Compound Name | 1-[(1R,5S)-6-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
|---|---|
| PubChem CID | 56912020 |
| Molecular Formula | C17H31N3O2 |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.24 |
| IUPAC Name | 1-[(1R,5S)-6-[[4-(2-propoxyethyl)piperazin-1-yl]methyl]-3-azabicyclo[3.1.0]hexan-3-yl]ethanone |
| SMILES | CCCOCCN1CCN(CC2[C@H]3CN(C(C)=O)C[C@@H]23)CC1 |
| InChI | InChI=1S/C17H31N3O2/c1-3-9-22-10-8-18-4-6-19(7-5-18)11-15-16-12-20(14(2)21)13-17(15)16/h15-17H,3-13H2,1-2H3/t15?,16-,17+ |
| InChIKey | UPHYNCLWAWURGK-ALOPSCKCSA-N |
| XLogP | 0.75 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|