C18H31N5O3 — CID 176640297
tert-butyl N-[2-[2-[4-(2-methylpyrimidin-5-yl)piperazin-1-yl]ethoxy]ethyl]carbamate (PubChem CID 176640297) has the molecular formula C18H31N5O3 and a molecular weight of 365.48 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(2-methylpyrimidin-5-yl)piperazin-1-yl]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(2-methylpyrimidin-5-yl)piperazin-1-yl]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 176640297 |
| Molecular Formula | C18H31N5O3 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(2-methylpyrimidin-5-yl)piperazin-1-yl]ethoxy]ethyl]carbamate |
| SMILES | Cc1ncc(N2CCN(CCOCCNC(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C18H31N5O3/c1-15-20-13-16(14-21-15)23-8-6-22(7-9-23)10-12-25-11-5-19-17(24)26-18(2,3)4/h13-14H,5-12H2,1-4H3,(H,19,24) |
| InChIKey | LIFSIQJLAWHAMS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|