C17H16N2O8S — CID 142184843
(3S)-3-[(4-nitro-2-phenylmethoxyphenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 142184843) has the molecular formula C17H16N2O8S and a molecular weight of 408.39 g/mol. Its IUPAC name is (3S)-3-[(4-nitro-2-phenylmethoxyphenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[(4-nitro-2-phenylmethoxyphenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 142184843 |
| Molecular Formula | C17H16N2O8S |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.06 |
| IUPAC Name | (3S)-3-[(4-nitro-2-phenylmethoxyphenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)NS(=O)(=O)c1ccc([N+](=O)[O-])cc1OCc1ccccc1 |
| InChI | InChI=1S/C17H16N2O8S/c20-10-13(8-17(21)22)18-28(25,26)16-7-6-14(19(23)24)9-15(16)27-11-12-4-2-1-3-5-12/h1-7,9-10,13,18H,8,11H2,(H,21,22)/t13-/m0/s1 |
| InChIKey | OJDTULWXHSTSTJ-ZDUSSCGKSA-N |
| XLogP | 1.49 |
| TPSA | 152.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|