C18H19NO6S — CID 18705159
4-oxo-3-[[2-(2-phenylethoxy)phenyl]sulfonylamino]butanoic acid (PubChem CID 18705159) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 4-oxo-3-[[2-(2-phenylethoxy)phenyl]sulfonylamino]butanoic acid.
| Compound Name | 4-oxo-3-[[2-(2-phenylethoxy)phenyl]sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 18705159 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 4-oxo-3-[[2-(2-phenylethoxy)phenyl]sulfonylamino]butanoic acid |
| SMILES | O=CC(CC(=O)O)NS(=O)(=O)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C18H19NO6S/c20-13-15(12-18(21)22)19-26(23,24)17-9-5-4-8-16(17)25-11-10-14-6-2-1-3-7-14/h1-9,13,15,19H,10-12H2,(H,21,22) |
| InChIKey | TZJVVRURBYMQGD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|