C24H24N2O7S — CID 22504147
3-[[4-carbamoyl-2-(1-naphthalen-1-ylpropan-2-yloxy)phenyl]sulfonylamino]-4-oxobutanoic acid (PubChem CID 22504147) has the molecular formula C24H24N2O7S and a molecular weight of 484.53 g/mol. Its IUPAC name is 3-[[4-carbamoyl-2-(1-naphthalen-1-ylpropan-2-yloxy)phenyl]sulfonylamino]-4-oxobutanoic acid.
| Compound Name | 3-[[4-carbamoyl-2-(1-naphthalen-1-ylpropan-2-yloxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22504147 |
| Molecular Formula | C24H24N2O7S |
| Molecular Weight | 484.53 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | 3-[[4-carbamoyl-2-(1-naphthalen-1-ylpropan-2-yloxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
| SMILES | CC(Cc1cccc2ccccc12)Oc1cc(C(N)=O)ccc1S(=O)(=O)NC(C=O)CC(=O)O |
| InChI | InChI=1S/C24H24N2O7S/c1-15(11-17-7-4-6-16-5-2-3-8-20(16)17)33-21-12-18(24(25)30)9-10-22(21)34(31,32)26-19(14-27)13-23(28)29/h2-10,12,14-15,19,26H,11,13H2,1H3,(H2,25,30)(H,28,29) |
| InChIKey | QKUWKASOIKXLFI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 152.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|