C30H36N2O6S — CID 86588220
tert-butyl (3S)-3-[[2-(2-naphthalen-1-ylethoxy)-4-pyrrolidin-1-ylphenyl]sulfonylamino]-4-oxobutanoate (PubChem CID 86588220) has the molecular formula C30H36N2O6S and a molecular weight of 552.69 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-(2-naphthalen-1-ylethoxy)-4-pyrrolidin-1-ylphenyl]sulfonylamino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-[[2-(2-naphthalen-1-ylethoxy)-4-pyrrolidin-1-ylphenyl]sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 86588220 |
| Molecular Formula | C30H36N2O6S |
| Molecular Weight | 552.69 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | tert-butyl (3S)-3-[[2-(2-naphthalen-1-ylethoxy)-4-pyrrolidin-1-ylphenyl]sulfonylamino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](C=O)NS(=O)(=O)c1ccc(N2CCCC2)cc1OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C30H36N2O6S/c1-30(2,3)38-29(34)19-24(21-33)31-39(35,36)28-14-13-25(32-16-6-7-17-32)20-27(28)37-18-15-23-11-8-10-22-9-4-5-12-26(22)23/h4-5,8-14,20-21,24,31H,6-7,15-19H2,1-3H3/t24-/m0/s1 |
| InChIKey | NMXXIOBRQMGRKZ-DEOSSOPVSA-N |
| XLogP | 4.64 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.69 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|