C27H33N3O7S — CID 86588234
tert-butyl (3S)-4-[methoxy(methyl)amino]-4-oxo-3-[[2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]butanoate (PubChem CID 86588234) has the molecular formula C27H33N3O7S and a molecular weight of 543.64 g/mol. Its IUPAC name is tert-butyl (3S)-4-[methoxy(methyl)amino]-4-oxo-3-[[2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]butanoate.
| Compound Name | tert-butyl (3S)-4-[methoxy(methyl)amino]-4-oxo-3-[[2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 86588234 |
| Molecular Formula | C27H33N3O7S |
| Molecular Weight | 543.64 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | tert-butyl (3S)-4-[methoxy(methyl)amino]-4-oxo-3-[[2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]butanoate |
| SMILES | CON(C)C(=O)[C@H](CC(=O)OC(C)(C)C)NS(=O)(=O)c1ccccc1OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C27H33N3O7S/c1-27(2,3)37-25(31)18-22(26(32)30(4)35-5)29-38(33,34)24-14-7-6-13-23(24)36-17-15-19-10-8-12-21-20(19)11-9-16-28-21/h6-14,16,22,29H,15,17-18H2,1-5H3/t22-/m0/s1 |
| InChIKey | YYWHBQJFVYDVJM-QFIPXVFZSA-N |
| XLogP | 3.25 |
| TPSA | 124.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.64 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|