C28H34N4O8S — CID 86588227
tert-butyl 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoate (PubChem CID 86588227) has the molecular formula C28H34N4O8S and a molecular weight of 586.67 g/mol. Its IUPAC name is tert-butyl 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 86588227 |
| Molecular Formula | C28H34N4O8S |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.21 |
| IUPAC Name | tert-butyl 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoate |
| SMILES | CON(C)C(=O)C(CC(=O)OC(C)(C)C)NS(=O)(=O)c1ccc(C(N)=O)cc1OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C28H34N4O8S/c1-28(2,3)40-25(33)17-22(27(35)32(4)38-5)31-41(36,37)24-12-11-19(26(29)34)16-23(24)39-15-13-18-8-6-10-21-20(18)9-7-14-30-21/h6-12,14,16,22,31H,13,15,17H2,1-5H3,(H2,29,34) |
| InChIKey | HXGVHSBTLPIOIJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 167.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|