C25H29N3O7S — CID 87969955
tert-butyl (3S)-3-[[6-methoxy-2-(2-quinolin-4-ylethoxy)-3-pyridinyl]sulfonylamino]-4-oxobutanoate (PubChem CID 87969955) has the molecular formula C25H29N3O7S and a molecular weight of 515.59 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[6-methoxy-2-(2-quinolin-4-ylethoxy)-3-pyridinyl]sulfonylamino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-[[6-methoxy-2-(2-quinolin-4-ylethoxy)-3-pyridinyl]sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87969955 |
| Molecular Formula | C25H29N3O7S |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | tert-butyl (3S)-3-[[6-methoxy-2-(2-quinolin-4-ylethoxy)-3-pyridinyl]sulfonylamino]-4-oxobutanoate |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C=O)CC(=O)OC(C)(C)C)c(OCCc2ccnc3ccccc23)n1 |
| InChI | InChI=1S/C25H29N3O7S/c1-25(2,3)35-23(30)15-18(16-29)28-36(31,32)21-9-10-22(33-4)27-24(21)34-14-12-17-11-13-26-20-8-6-5-7-19(17)20/h5-11,13,16,18,28H,12,14-15H2,1-4H3/t18-/m0/s1 |
| InChIKey | MKVOEMFZGFIFLD-SFHVURJKSA-N |
| XLogP | 2.84 |
| TPSA | 133.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|