C22H24N4O6S — CID 22504245
3-[[4-amino-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-(methylamino)-4-oxobutanoic acid (PubChem CID 22504245) has the molecular formula C22H24N4O6S and a molecular weight of 472.52 g/mol. Its IUPAC name is 3-[[4-amino-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-(methylamino)-4-oxobutanoic acid.
| Compound Name | 3-[[4-amino-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-(methylamino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22504245 |
| Molecular Formula | C22H24N4O6S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[[4-amino-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-(methylamino)-4-oxobutanoic acid |
| SMILES | CNC(=O)C(CC(=O)O)NS(=O)(=O)c1ccc(N)cc1OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C22H24N4O6S/c1-24-22(29)18(13-21(27)28)26-33(30,31)20-8-7-15(23)12-19(20)32-11-9-14-4-2-6-17-16(14)5-3-10-25-17/h2-8,10,12,18,26H,9,11,13,23H2,1H3,(H,24,29)(H,27,28) |
| InChIKey | SXHKUFWUGPJFCF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 160.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|