C25H28N4O7S — CID 87952745
(3S)-3-[[4-[[2-(dimethylamino)acetyl]amino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid (PubChem CID 87952745) has the molecular formula C25H28N4O7S and a molecular weight of 528.59 g/mol. Its IUPAC name is (3S)-3-[[4-[[2-(dimethylamino)acetyl]amino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[[4-[[2-(dimethylamino)acetyl]amino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87952745 |
| Molecular Formula | C25H28N4O7S |
| Molecular Weight | 528.59 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | (3S)-3-[[4-[[2-(dimethylamino)acetyl]amino]-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-oxobutanoic acid |
| SMILES | CN(C)CC(=O)Nc1ccc(S(=O)(=O)N[C@H](C=O)CC(=O)O)c(OCCc2cccc3ncccc23)c1 |
| InChI | InChI=1S/C25H28N4O7S/c1-29(2)15-24(31)27-18-8-9-23(37(34,35)28-19(16-30)14-25(32)33)22(13-18)36-12-10-17-5-3-7-21-20(17)6-4-11-26-21/h3-9,11,13,16,19,28H,10,12,14-15H2,1-2H3,(H,27,31)(H,32,33)/t19-/m0/s1 |
| InChIKey | FOBZPCNPODXPTF-IBGZPJMESA-N |
| XLogP | 1.68 |
| TPSA | 155.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.59 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|