C22H20N4O6S — CID 10139954
(3R)-3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-3-cyanopropanoic acid (PubChem CID 10139954) has the molecular formula C22H20N4O6S and a molecular weight of 468.49 g/mol. Its IUPAC name is (3R)-3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-3-cyanopropanoic acid.
| Compound Name | (3R)-3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-3-cyanopropanoic acid |
|---|---|
| PubChem CID | 10139954 |
| Molecular Formula | C22H20N4O6S |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.11 |
| IUPAC Name | (3R)-3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-3-cyanopropanoic acid |
| SMILES | N#C[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(C(N)=O)cc1OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C22H20N4O6S/c23-13-16(12-21(27)28)26-33(30,31)20-7-6-15(22(24)29)11-19(20)32-10-8-14-3-1-5-18-17(14)4-2-9-25-18/h1-7,9,11,16,26H,8,10,12H2,(H2,24,29)(H,27,28)/t16-/m1/s1 |
| InChIKey | KDUQKQQPLJPGOK-MRXNPFEDSA-N |
| XLogP | 1.60 |
| TPSA | 172.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |