C24H26N4O8S — CID 22503995
3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoic acid (PubChem CID 22503995) has the molecular formula C24H26N4O8S and a molecular weight of 530.56 g/mol. Its IUPAC name is 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoic acid.
| Compound Name | 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 22503995 |
| Molecular Formula | C24H26N4O8S |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | 3-[[4-carbamoyl-2-(2-quinolin-5-ylethoxy)phenyl]sulfonylamino]-4-[methoxy(methyl)amino]-4-oxobutanoic acid |
| SMILES | CON(C)C(=O)C(CC(=O)O)NS(=O)(=O)c1ccc(C(N)=O)cc1OCCc1cccc2ncccc12 |
| InChI | InChI=1S/C24H26N4O8S/c1-28(35-2)24(32)19(14-22(29)30)27-37(33,34)21-9-8-16(23(25)31)13-20(21)36-12-10-15-5-3-7-18-17(15)6-4-11-26-18/h3-9,11,13,19,27H,10,12,14H2,1-2H3,(H2,25,31)(H,29,30) |
| InChIKey | UHGFMOBGLQDNKW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 178.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|