C37H54N2O8SSi — CID 86588230
tert-butyl 4-[methoxy(methyl)amino]-4-oxo-3-[[2-[2-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]ethoxy]phenyl]sulfonylamino]butanoate (PubChem CID 86588230) has the molecular formula C37H54N2O8SSi and a molecular weight of 715.00 g/mol. Its IUPAC name is tert-butyl 4-[methoxy(methyl)amino]-4-oxo-3-[[2-[2-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]ethoxy]phenyl]sulfonylamino]butanoate.
| Compound Name | tert-butyl 4-[methoxy(methyl)amino]-4-oxo-3-[[2-[2-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]ethoxy]phenyl]sulfonylamino]butanoate |
|---|---|
| PubChem CID | 86588230 |
| Molecular Formula | C37H54N2O8SSi |
| Molecular Weight | 715.00 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | tert-butyl 4-[methoxy(methyl)amino]-4-oxo-3-[[2-[2-[2-tri(propan-2-yl)silyloxynaphthalen-1-yl]ethoxy]phenyl]sulfonylamino]butanoate |
| SMILES | CON(C)C(=O)C(CC(=O)OC(C)(C)C)NS(=O)(=O)c1ccccc1OCCc1c(O[Si](C(C)C)(C(C)C)C(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C37H54N2O8SSi/c1-25(2)49(26(3)4,27(5)6)47-32-21-20-28-16-12-13-17-29(28)30(32)22-23-45-33-18-14-15-19-34(33)48(42,43)38-31(36(41)39(10)44-11)24-35(40)46-37(7,8)9/h12-21,25-27,31,38H,22-24H2,1-11H3 |
| InChIKey | ZCNDJIKUCCFSBH-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 120.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.00 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|