C17H21NO4S — CID 3667575
tert-butyl 3-(naphthalen-1-ylsulfonylamino)propanoate (PubChem CID 3667575) has the molecular formula C17H21NO4S and a molecular weight of 335.42 g/mol. Its IUPAC name is tert-butyl 3-(naphthalen-1-ylsulfonylamino)propanoate.
| Compound Name | tert-butyl 3-(naphthalen-1-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 3667575 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.42 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | tert-butyl 3-(naphthalen-1-ylsulfonylamino)propanoate |
| SMILES | CC(C)(C)OC(=O)CCNS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H21NO4S/c1-17(2,3)22-16(19)11-12-18-23(20,21)15-10-6-8-13-7-4-5-9-14(13)15/h4-10,18H,11-12H2,1-3H3 |
| InChIKey | ASWIFVYORYGRDD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |