C30H40N2O4 — CID 22026217
tert-butyl 3-[[10-[[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]methyl]anthracen-9-yl]methylamino]propanoate (PubChem CID 22026217) has the molecular formula C30H40N2O4 and a molecular weight of 492.66 g/mol. Its IUPAC name is tert-butyl 3-[[10-[[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]methyl]anthracen-9-yl]methylamino]propanoate.
| Compound Name | tert-butyl 3-[[10-[[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]methyl]anthracen-9-yl]methylamino]propanoate |
|---|---|
| PubChem CID | 22026217 |
| Molecular Formula | C30H40N2O4 |
| Molecular Weight | 492.66 g/mol |
| Exact Mass | 492.30 |
| IUPAC Name | tert-butyl 3-[[10-[[[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]amino]methyl]anthracen-9-yl]methylamino]propanoate |
| SMILES | CC(C)(C)OC(=O)CCNCc1c2ccccc2c(CNCCC(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C30H40N2O4/c1-29(2,3)35-27(33)15-17-31-19-25-21-11-7-9-13-23(21)26(24-14-10-8-12-22(24)25)20-32-18-16-28(34)36-30(4,5)6/h7-14,31-32H,15-20H2,1-6H3 |
| InChIKey | OVGSAMHLIFJBCO-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.66 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|