C30H41N3O3 — CID 143686145
tert-butyl 3-[[10-[[2-(methylamino)ethylamino]methyl]anthracen-9-yl]methylamino]propanoate;2-methylprop-2-enal (PubChem CID 143686145) has the molecular formula C30H41N3O3 and a molecular weight of 491.68 g/mol. Its IUPAC name is tert-butyl 3-[[10-[[2-(methylamino)ethylamino]methyl]anthracen-9-yl]methylamino]propanoate;2-methylprop-2-enal.
| Compound Name | tert-butyl 3-[[10-[[2-(methylamino)ethylamino]methyl]anthracen-9-yl]methylamino]propanoate;2-methylprop-2-enal |
|---|---|
| PubChem CID | 143686145 |
| Molecular Formula | C30H41N3O3 |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | tert-butyl 3-[[10-[[2-(methylamino)ethylamino]methyl]anthracen-9-yl]methylamino]propanoate;2-methylprop-2-enal |
| SMILES | C=C(C)C=O.CNCCNCc1c2ccccc2c(CNCCC(=O)OC(C)(C)C)c2ccccc12 |
| InChI | InChI=1S/C26H35N3O2.C4H6O/c1-26(2,3)31-25(30)13-14-28-17-23-19-9-5-7-11-21(19)24(18-29-16-15-27-4)22-12-8-6-10-20(22)23;1-4(2)3-5/h5-12,27-29H,13-18H2,1-4H3;3H,1H2,2H3 |
| InChIKey | DOTMQTQHFJPNPP-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|