C28H41NO6S — CID 87956759
tert-butyl (3S)-3-[[2-[2-(2-methyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propoxy]phenyl]sulfonylamino]-4-oxobutanoate (PubChem CID 87956759) has the molecular formula C28H41NO6S and a molecular weight of 519.70 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-[2-(2-methyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propoxy]phenyl]sulfonylamino]-4-oxobutanoate.
| Compound Name | tert-butyl (3S)-3-[[2-[2-(2-methyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propoxy]phenyl]sulfonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 87956759 |
| Molecular Formula | C28H41NO6S |
| Molecular Weight | 519.70 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | tert-butyl (3S)-3-[[2-[2-(2-methyl-3,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl)propoxy]phenyl]sulfonylamino]-4-oxobutanoate |
| SMILES | CC1=C(C(C)COc2ccccc2S(=O)(=O)N[C@H](C=O)CC(=O)OC(C)(C)C)C2CCCCC2CC1 |
| InChI | InChI=1S/C28H41NO6S/c1-19-14-15-21-10-6-7-11-23(21)27(19)20(2)18-34-24-12-8-9-13-25(24)36(32,33)29-22(17-30)16-26(31)35-28(3,4)5/h8-9,12-13,17,20-23,29H,6-7,10-11,14-16,18H2,1-5H3/t20?,21?,22-,23?/m0/s1 |
| InChIKey | WGYLLFVNYYEBSR-VPMYNCEMSA-N |
| XLogP | 5.20 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.70 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|