C16H21NO6S — CID 18705173
3-[(2-cyclohexyloxyphenyl)sulfonylamino]-4-oxobutanoic acid (PubChem CID 18705173) has the molecular formula C16H21NO6S and a molecular weight of 355.41 g/mol. Its IUPAC name is 3-[(2-cyclohexyloxyphenyl)sulfonylamino]-4-oxobutanoic acid.
| Compound Name | 3-[(2-cyclohexyloxyphenyl)sulfonylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 18705173 |
| Molecular Formula | C16H21NO6S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 3-[(2-cyclohexyloxyphenyl)sulfonylamino]-4-oxobutanoic acid |
| SMILES | O=CC(CC(=O)O)NS(=O)(=O)c1ccccc1OC1CCCCC1 |
| InChI | InChI=1S/C16H21NO6S/c18-11-12(10-16(19)20)17-24(21,22)15-9-5-4-8-14(15)23-13-6-2-1-3-7-13/h4-5,8-9,11-13,17H,1-3,6-7,10H2,(H,19,20) |
| InChIKey | KFPTXTJOUJUPAJ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|