C14H22N2O3 — CID 111485416
N-(2-hydroxy-2,5-dimethylhexyl)-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 111485416) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(2-hydroxy-2,5-dimethylhexyl)-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-(2-hydroxy-2,5-dimethylhexyl)-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 111485416 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(2-hydroxy-2,5-dimethylhexyl)-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C14H22N2O3/c1-11(2)6-7-14(3,18)10-15-13(17)12-5-4-8-16(19)9-12/h4-5,8-9,11,18H,6-7,10H2,1-3H3,(H,15,17) |
| InChIKey | KCGPPMIOVACTKI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 76.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|