C18H21N3O4 — CID 166397509
N-[(2R)-2-[[2-(4-hydroxyphenyl)acetyl]-methylamino]propyl]-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 166397509) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is N-[(2R)-2-[[2-(4-hydroxyphenyl)acetyl]-methylamino]propyl]-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[(2R)-2-[[2-(4-hydroxyphenyl)acetyl]-methylamino]propyl]-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 166397509 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[(2R)-2-[[2-(4-hydroxyphenyl)acetyl]-methylamino]propyl]-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | C[C@H](CNC(=O)c1ccc[n+]([O-])c1)N(C)C(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-13(11-19-18(24)15-4-3-9-21(25)12-15)20(2)17(23)10-14-5-7-16(22)8-6-14/h3-9,12-13,22H,10-11H2,1-2H3,(H,19,24)/t13-/m1/s1 |
| InChIKey | FFOMPLNZVGRJJQ-CYBMUJFWSA-N |
| XLogP | 0.85 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|