C16H18N2O4 — CID 18272561
N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-1-oxidopyridin-1-ium-3-carboxamide (PubChem CID 18272561) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-1-oxidopyridin-1-ium-3-carboxamide.
| Compound Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-1-oxidopyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 18272561 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N-[(3,4-dimethoxyphenyl)methyl]-N-methyl-1-oxidopyridin-1-ium-3-carboxamide |
| SMILES | COc1ccc(CN(C)C(=O)c2ccc[n+]([O-])c2)cc1OC |
| InChI | InChI=1S/C16H18N2O4/c1-17(16(19)13-5-4-8-18(20)11-13)10-12-6-7-14(21-2)15(9-12)22-3/h4-9,11H,10H2,1-3H3 |
| InChIKey | FJTHMNDIXXKKQL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|