C28H27ClN2O4 — CID 161282145
benzamide;1-chloro-4-methoxybenzene;N-(4-methoxyphenyl)benzamide (PubChem CID 161282145) has the molecular formula C28H27ClN2O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is benzamide;1-chloro-4-methoxybenzene;N-(4-methoxyphenyl)benzamide.
| Compound Name | benzamide;1-chloro-4-methoxybenzene;N-(4-methoxyphenyl)benzamide |
|---|---|
| PubChem CID | 161282145 |
| Molecular Formula | C28H27ClN2O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | benzamide;1-chloro-4-methoxybenzene;N-(4-methoxyphenyl)benzamide |
| SMILES | COc1ccc(Cl)cc1.COc1ccc(NC(=O)c2ccccc2)cc1.NC(=O)c1ccccc1 |
| InChI | InChI=1S/C14H13NO2.C7H7ClO.C7H7NO/c1-17-13-9-7-12(8-10-13)15-14(16)11-5-3-2-4-6-11;1-9-7-4-2-6(8)3-5-7;8-7(9)6-4-2-1-3-5-6/h2-10H,1H3,(H,15,16);2-5H,1H3;1-5H,(H2,8,9) |
| InChIKey | VFFRSUGNEFNJBC-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |