C15H15N7NaO2 — CID 70528241
CID 70528241 (PubChem CID 70528241) has the molecular formula C15H15N7NaO2 and a molecular weight of 348.32 g/mol.
| Compound Name | CID 70528241 |
|---|---|
| PubChem CID | 70528241 |
| Molecular Formula | C15H15N7NaO2 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | — |
| SMILES | CNc1ccc(-c2cc(OC)cc(C(=O)Nc3nn[nH]n3)n2)cc1.[Na] |
| InChI | InChI=1S/C15H15N7O2.Na/c1-16-10-5-3-9(4-6-10)12-7-11(24-2)8-13(17-12)14(23)18-15-19-21-22-20-15;/h3-8,16H,1-2H3,(H2,18,19,20,21,22,23); |
| InChIKey | NYGHQTZBUMYPHQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 117.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |