C36H56N2O6S — CID 54329903
2-[(4-methylphenyl)sulfonyl-octadec-9-enylamino]-N-(2,4,6-trimethoxyphenyl)acetamide (PubChem CID 54329903) has the molecular formula C36H56N2O6S and a molecular weight of 644.92 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonyl-octadec-9-enylamino]-N-(2,4,6-trimethoxyphenyl)acetamide.
| Compound Name | 2-[(4-methylphenyl)sulfonyl-octadec-9-enylamino]-N-(2,4,6-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 54329903 |
| Molecular Formula | C36H56N2O6S |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.39 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonyl-octadec-9-enylamino]-N-(2,4,6-trimethoxyphenyl)acetamide |
| SMILES | CCCCCCCCC=CCCCCCCCCN(CC(=O)Nc1c(OC)cc(OC)cc1OC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C36H56N2O6S/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26-38(45(40,41)32-24-22-30(2)23-25-32)29-35(39)37-36-33(43-4)27-31(42-3)28-34(36)44-5/h13-14,22-25,27-28H,6-12,15-21,26,29H2,1-5H3,(H,37,39) |
| InChIKey | SXPIMNLAHOHHAU-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|