C31H54N2O3 — CID 54406866
N-[3-methoxy-4-[2-methyl-2-(octadec-9-enylamino)propoxy]phenyl]acetamide (PubChem CID 54406866) has the molecular formula C31H54N2O3 and a molecular weight of 502.78 g/mol. Its IUPAC name is N-[3-methoxy-4-[2-methyl-2-(octadec-9-enylamino)propoxy]phenyl]acetamide.
| Compound Name | N-[3-methoxy-4-[2-methyl-2-(octadec-9-enylamino)propoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 54406866 |
| Molecular Formula | C31H54N2O3 |
| Molecular Weight | 502.78 g/mol |
| Exact Mass | 502.41 |
| IUPAC Name | N-[3-methoxy-4-[2-methyl-2-(octadec-9-enylamino)propoxy]phenyl]acetamide |
| SMILES | CCCCCCCCC=CCCCCCCCCNC(C)(C)COc1ccc(NC(C)=O)cc1OC |
| InChI | InChI=1S/C31H54N2O3/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-32-31(3,4)26-36-29-23-22-28(33-27(2)34)25-30(29)35-5/h13-14,22-23,25,32H,6-12,15-21,24,26H2,1-5H3,(H,33,34) |
| InChIKey | VRHWQKUDIFCBIU-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.78 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|