C33H41NO5 — CID 139610182
ethyl 4-[2-[[2-ethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate (PubChem CID 139610182) has the molecular formula C33H41NO5 and a molecular weight of 531.69 g/mol. Its IUPAC name is ethyl 4-[2-[[2-ethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[[2-ethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate |
|---|---|
| PubChem CID | 139610182 |
| Molecular Formula | C33H41NO5 |
| Molecular Weight | 531.69 g/mol |
| Exact Mass | 531.30 |
| IUPAC Name | ethyl 4-[2-[[2-ethyl-4-[1-[4-(2-methylpropyl)phenyl]ethoxy]phenyl]carbamoyl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1C(=O)Nc1ccc(OC(C)c2ccc(CC(C)C)cc2)cc1CC |
| InChI | InChI=1S/C33H41NO5/c1-6-26-22-28(39-24(5)27-16-14-25(15-17-27)21-23(3)4)18-19-30(26)34-33(36)29-11-8-9-12-31(29)38-20-10-13-32(35)37-7-2/h8-9,11-12,14-19,22-24H,6-7,10,13,20-21H2,1-5H3,(H,34,36) |
| InChIKey | MIAALEKTIYUQNE-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.69 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|