C36H38N2O6 — CID 57061018
ethyl 6-[2-[[4-[[(2-phenylmethoxybenzoyl)amino]methyl]benzoyl]amino]phenoxy]hexanoate (PubChem CID 57061018) has the molecular formula C36H38N2O6 and a molecular weight of 594.71 g/mol. Its IUPAC name is ethyl 6-[2-[[4-[[(2-phenylmethoxybenzoyl)amino]methyl]benzoyl]amino]phenoxy]hexanoate.
| Compound Name | ethyl 6-[2-[[4-[[(2-phenylmethoxybenzoyl)amino]methyl]benzoyl]amino]phenoxy]hexanoate |
|---|---|
| PubChem CID | 57061018 |
| Molecular Formula | C36H38N2O6 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.27 |
| IUPAC Name | ethyl 6-[2-[[4-[[(2-phenylmethoxybenzoyl)amino]methyl]benzoyl]amino]phenoxy]hexanoate |
| SMILES | CCOC(=O)CCCCCOc1ccccc1NC(=O)c1ccc(CNC(=O)c2ccccc2OCc2ccccc2)cc1 |
| InChI | InChI=1S/C36H38N2O6/c1-2-42-34(39)19-7-4-12-24-43-33-18-11-9-16-31(33)38-35(40)29-22-20-27(21-23-29)25-37-36(41)30-15-8-10-17-32(30)44-26-28-13-5-3-6-14-28/h3,5-6,8-11,13-18,20-23H,2,4,7,12,19,24-26H2,1H3,(H,37,41)(H,38,40) |
| InChIKey | KGNZMBRQQGILLS-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|