C33H42N2O5 — CID 139610103
N-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-[4-(hydroxyamino)-4-oxobutoxy]benzamide (PubChem CID 139610103) has the molecular formula C33H42N2O5 and a molecular weight of 546.71 g/mol. Its IUPAC name is N-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-[4-(hydroxyamino)-4-oxobutoxy]benzamide.
| Compound Name | N-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-[4-(hydroxyamino)-4-oxobutoxy]benzamide |
|---|---|
| PubChem CID | 139610103 |
| Molecular Formula | C33H42N2O5 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.31 |
| IUPAC Name | N-[2,3-dimethyl-4-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-[4-(hydroxyamino)-4-oxobutoxy]benzamide |
| SMILES | CCCC(Oc1ccc(NC(=O)c2ccccc2OCCCC(=O)NO)c(C)c1C)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C33H42N2O5/c1-6-10-30(26-16-14-25(15-17-26)21-22(2)3)40-29-19-18-28(23(4)24(29)5)34-33(37)27-11-7-8-12-31(27)39-20-9-13-32(36)35-38/h7-8,11-12,14-19,22,30,38H,6,9-10,13,20-21H2,1-5H3,(H,34,37)(H,35,36) |
| InChIKey | RLRAEVBLNXEFHN-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|