C27H31NO2 — CID 23203299
1-[2-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-pyridin-2-ylethanone (PubChem CID 23203299) has the molecular formula C27H31NO2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 1-[2-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-pyridin-2-ylethanone.
| Compound Name | 1-[2-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-pyridin-2-ylethanone |
|---|---|
| PubChem CID | 23203299 |
| Molecular Formula | C27H31NO2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 1-[2-[1-[4-(2-methylpropyl)phenyl]butoxy]phenyl]-2-pyridin-2-ylethanone |
| SMILES | CCCC(Oc1ccccc1C(=O)Cc1ccccn1)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C27H31NO2/c1-4-9-26(22-15-13-21(14-16-22)18-20(2)3)30-27-12-6-5-11-24(27)25(29)19-23-10-7-8-17-28-23/h5-8,10-17,20,26H,4,9,18-19H2,1-3H3 |
| InChIKey | ZACPQKKXNUTWLR-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |