C27H37NO3S — CID 54559310
4-[2-(11-phenylundecanethioylamino)phenoxy]butanoic acid (PubChem CID 54559310) has the molecular formula C27H37NO3S and a molecular weight of 455.66 g/mol. Its IUPAC name is 4-[2-(11-phenylundecanethioylamino)phenoxy]butanoic acid.
| Compound Name | 4-[2-(11-phenylundecanethioylamino)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 54559310 |
| Molecular Formula | C27H37NO3S |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | 4-[2-(11-phenylundecanethioylamino)phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccccc1NC(=S)CCCCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C27H37NO3S/c29-27(30)21-14-22-31-25-19-13-12-18-24(25)28-26(32)20-11-6-4-2-1-3-5-8-15-23-16-9-7-10-17-23/h7,9-10,12-13,16-19H,1-6,8,11,14-15,20-22H2,(H,28,32)(H,29,30) |
| InChIKey | ZPKKLAHCWOSFTP-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|