C34H29F2NO5 — CID 139721636
ethyl 4-[2-[5-[bis(4-fluorophenyl)methylcarbamoyl]-1-benzofuran-2-yl]phenoxy]butanoate (PubChem CID 139721636) has the molecular formula C34H29F2NO5 and a molecular weight of 569.60 g/mol. Its IUPAC name is ethyl 4-[2-[5-[bis(4-fluorophenyl)methylcarbamoyl]-1-benzofuran-2-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[5-[bis(4-fluorophenyl)methylcarbamoyl]-1-benzofuran-2-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 139721636 |
| Molecular Formula | C34H29F2NO5 |
| Molecular Weight | 569.60 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | ethyl 4-[2-[5-[bis(4-fluorophenyl)methylcarbamoyl]-1-benzofuran-2-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1-c1cc2cc(C(=O)NC(c3ccc(F)cc3)c3ccc(F)cc3)ccc2o1 |
| InChI | InChI=1S/C34H29F2NO5/c1-2-40-32(38)8-5-19-41-30-7-4-3-6-28(30)31-21-25-20-24(13-18-29(25)42-31)34(39)37-33(22-9-14-26(35)15-10-22)23-11-16-27(36)17-12-23/h3-4,6-7,9-18,20-21,33H,2,5,8,19H2,1H3,(H,37,39) |
| InChIKey | XSVVZQWMQGZVEJ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.60 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|