C18H22N4O5 — CID 59285985
ethyl 4-[2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]phenoxy]butanoate (PubChem CID 59285985) has the molecular formula C18H22N4O5 and a molecular weight of 374.40 g/mol. Its IUPAC name is ethyl 4-[2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]phenoxy]butanoate.
| Compound Name | ethyl 4-[2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 59285985 |
| Molecular Formula | C18H22N4O5 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | ethyl 4-[2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CCCOc1ccccc1-c1cc(C(N)=O)c(NC(N)=O)[nH]1 |
| InChI | InChI=1S/C18H22N4O5/c1-2-26-15(23)8-5-9-27-14-7-4-3-6-11(14)13-10-12(16(19)24)17(21-13)22-18(20)25/h3-4,6-7,10,21H,2,5,8-9H2,1H3,(H2,19,24)(H3,20,22,25) |
| InChIKey | OWXKPJGJWDZCSX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 149.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|