C19H25N5O3 — CID 69008761
2-(carbamoylamino)-5-[2-(1-pyrrolidin-1-ylpropoxy)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 69008761) has the molecular formula C19H25N5O3 and a molecular weight of 371.44 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[2-(1-pyrrolidin-1-ylpropoxy)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[2-(1-pyrrolidin-1-ylpropoxy)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 69008761 |
| Molecular Formula | C19H25N5O3 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 2-(carbamoylamino)-5-[2-(1-pyrrolidin-1-ylpropoxy)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | CCC(Oc1ccccc1-c1cc(C(N)=O)c(NC(N)=O)[nH]1)N1CCCC1 |
| InChI | InChI=1S/C19H25N5O3/c1-2-16(24-9-5-6-10-24)27-15-8-4-3-7-12(15)14-11-13(17(20)25)18(22-14)23-19(21)26/h3-4,7-8,11,16,22H,2,5-6,9-10H2,1H3,(H2,20,25)(H3,21,23,26) |
| InChIKey | RILISWAUPLREEE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 126.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |