C15H16N4O4 — CID 145464632
[2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]-4-methylphenyl] acetate (PubChem CID 145464632) has the molecular formula C15H16N4O4 and a molecular weight of 316.32 g/mol. Its IUPAC name is [2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]-4-methylphenyl] acetate.
| Compound Name | [2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]-4-methylphenyl] acetate |
|---|---|
| PubChem CID | 145464632 |
| Molecular Formula | C15H16N4O4 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [2-[4-carbamoyl-5-(carbamoylamino)-1H-pyrrol-2-yl]-4-methylphenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C)cc1-c1cc(C(N)=O)c(NC(N)=O)[nH]1 |
| InChI | InChI=1S/C15H16N4O4/c1-7-3-4-12(23-8(2)20)9(5-7)11-6-10(13(16)21)14(18-11)19-15(17)22/h3-6,18H,1-2H3,(H2,16,21)(H3,17,19,22) |
| InChIKey | VQLOERAYZGHPIY-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 140.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|