C17H22N4O5 — CID 67314576
2-(carbamoylamino)-5-[2-[2-(1-methoxyethoxy)ethoxy]phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 67314576) has the molecular formula C17H22N4O5 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[2-[2-(1-methoxyethoxy)ethoxy]phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[2-[2-(1-methoxyethoxy)ethoxy]phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 67314576 |
| Molecular Formula | C17H22N4O5 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-(carbamoylamino)-5-[2-[2-(1-methoxyethoxy)ethoxy]phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | COC(C)OCCOc1ccccc1-c1cc(C(N)=O)c(NC(N)=O)[nH]1 |
| InChI | InChI=1S/C17H22N4O5/c1-10(24-2)25-7-8-26-14-6-4-3-5-11(14)13-9-12(15(18)22)16(20-13)21-17(19)23/h3-6,9-10,20H,7-8H2,1-2H3,(H2,18,22)(H3,19,21,23) |
| InChIKey | QOUYTCZBRRNSQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 141.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|