C19H18N4O3 — CID 59285855
2-(carbamoylamino)-5-(2-phenylmethoxyphenyl)-1H-pyrrole-3-carboxamide (PubChem CID 59285855) has the molecular formula C19H18N4O3 and a molecular weight of 350.38 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-(2-phenylmethoxyphenyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-(2-phenylmethoxyphenyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59285855 |
| Molecular Formula | C19H18N4O3 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 2-(carbamoylamino)-5-(2-phenylmethoxyphenyl)-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c(-c2ccccc2OCc2ccccc2)cc1C(N)=O |
| InChI | InChI=1S/C19H18N4O3/c20-17(24)14-10-15(22-18(14)23-19(21)25)13-8-4-5-9-16(13)26-11-12-6-2-1-3-7-12/h1-10,22H,11H2,(H2,20,24)(H3,21,23,25) |
| InChIKey | DOZQEKQXLJOUFW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 123.23 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |