C18H16FN5O3 — CID 59285990
2-(carbamoylamino)-5-[5-fluoro-2-(pyridin-3-ylmethoxy)phenyl]-1H-pyrrole-3-carboxamide (PubChem CID 59285990) has the molecular formula C18H16FN5O3 and a molecular weight of 369.36 g/mol. Its IUPAC name is 2-(carbamoylamino)-5-[5-fluoro-2-(pyridin-3-ylmethoxy)phenyl]-1H-pyrrole-3-carboxamide.
| Compound Name | 2-(carbamoylamino)-5-[5-fluoro-2-(pyridin-3-ylmethoxy)phenyl]-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 59285990 |
| Molecular Formula | C18H16FN5O3 |
| Molecular Weight | 369.36 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-(carbamoylamino)-5-[5-fluoro-2-(pyridin-3-ylmethoxy)phenyl]-1H-pyrrole-3-carboxamide |
| SMILES | NC(=O)Nc1[nH]c(-c2cc(F)ccc2OCc2cccnc2)cc1C(N)=O |
| InChI | InChI=1S/C18H16FN5O3/c19-11-3-4-15(27-9-10-2-1-5-22-8-10)12(6-11)14-7-13(16(20)25)17(23-14)24-18(21)26/h1-8,23H,9H2,(H2,20,25)(H3,21,24,26) |
| InChIKey | ZFIXEZQHZANRDK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 136.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |