C19H17FN4O2 — CID 59509065
N-[6-(2-ethoxy-5-fluorophenyl)pyrimidin-4-yl]-2-pyridin-3-ylacetamide (PubChem CID 59509065) has the molecular formula C19H17FN4O2 and a molecular weight of 352.37 g/mol. Its IUPAC name is N-[6-(2-ethoxy-5-fluorophenyl)pyrimidin-4-yl]-2-pyridin-3-ylacetamide.
| Compound Name | N-[6-(2-ethoxy-5-fluorophenyl)pyrimidin-4-yl]-2-pyridin-3-ylacetamide |
|---|---|
| PubChem CID | 59509065 |
| Molecular Formula | C19H17FN4O2 |
| Molecular Weight | 352.37 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | N-[6-(2-ethoxy-5-fluorophenyl)pyrimidin-4-yl]-2-pyridin-3-ylacetamide |
| SMILES | CCOc1ccc(F)cc1-c1cc(NC(=O)Cc2cccnc2)ncn1 |
| InChI | InChI=1S/C19H17FN4O2/c1-2-26-17-6-5-14(20)9-15(17)16-10-18(23-12-22-16)24-19(25)8-13-4-3-7-21-11-13/h3-7,9-12H,2,8H2,1H3,(H,22,23,24,25) |
| InChIKey | PSPMMWFJPHFWNF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |