C16H15FN4O3 — CID 59509071
1-N'-[6-(5-fluoro-2-methoxyphenyl)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide (PubChem CID 59509071) has the molecular formula C16H15FN4O3 and a molecular weight of 330.32 g/mol. Its IUPAC name is 1-N'-[6-(5-fluoro-2-methoxyphenyl)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide.
| Compound Name | 1-N'-[6-(5-fluoro-2-methoxyphenyl)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide |
|---|---|
| PubChem CID | 59509071 |
| Molecular Formula | C16H15FN4O3 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 1-N'-[6-(5-fluoro-2-methoxyphenyl)pyrimidin-4-yl]cyclopropane-1,1-dicarboxamide |
| SMILES | COc1ccc(F)cc1-c1cc(NC(=O)C2(C(N)=O)CC2)ncn1 |
| InChI | InChI=1S/C16H15FN4O3/c1-24-12-3-2-9(17)6-10(12)11-7-13(20-8-19-11)21-15(23)16(4-5-16)14(18)22/h2-3,6-8H,4-5H2,1H3,(H2,18,22)(H,19,20,21,23) |
| InChIKey | XPISCKGHTONQMF-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|