C19H15F2N4O3+ — CID 137104453
[2-[6-(5-carbamoyl-2-fluoro-4-methoxyanilino)pyrimidin-4-yl]-4-fluorophenyl]-methylideneoxidanium (PubChem CID 137104453) has the molecular formula C19H15F2N4O3+ and a molecular weight of 385.35 g/mol. Its IUPAC name is [2-[6-(5-carbamoyl-2-fluoro-4-methoxyanilino)pyrimidin-4-yl]-4-fluorophenyl]-methylideneoxidanium.
| Compound Name | [2-[6-(5-carbamoyl-2-fluoro-4-methoxyanilino)pyrimidin-4-yl]-4-fluorophenyl]-methylideneoxidanium |
|---|---|
| PubChem CID | 137104453 |
| Molecular Formula | C19H15F2N4O3+ |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | [2-[6-(5-carbamoyl-2-fluoro-4-methoxyanilino)pyrimidin-4-yl]-4-fluorophenyl]-methylideneoxidanium |
| SMILES | C=[O+]c1ccc(F)cc1-c1cc(Nc2cc(C(N)=O)c(OC)cc2F)ncn1 |
| InChI | InChI=1S/C19H14F2N4O3/c1-27-16-4-3-10(20)5-11(16)14-8-18(24-9-23-14)25-15-6-12(19(22)26)17(28-2)7-13(15)21/h3-9H,1H2,2H3,(H2-,22,23,24,25,26)/p+1 |
| InChIKey | DPARRTRGOCUGSS-UHFFFAOYSA-O |
| XLogP | 3.35 |
| TPSA | 101.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|