C30H30N6O5 — CID 135369359
2-methoxy-5-[6-[2-methoxy-4-(2-methoxy-N-methylanilino)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]benzamide (PubChem CID 135369359) has the molecular formula C30H30N6O5 and a molecular weight of 554.61 g/mol. Its IUPAC name is 2-methoxy-5-[6-[2-methoxy-4-(2-methoxy-N-methylanilino)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | 2-methoxy-5-[6-[2-methoxy-4-(2-methoxy-N-methylanilino)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 135369359 |
| Molecular Formula | C30H30N6O5 |
| Molecular Weight | 554.61 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 2-methoxy-5-[6-[2-methoxy-4-(2-methoxy-N-methylanilino)-5-(prop-2-enoylamino)anilino]pyrimidin-4-yl]benzamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(-c3ccc(OC)c(C(N)=O)c3)ncn2)c(OC)cc1N(C)c1ccccc1OC |
| InChI | InChI=1S/C30H30N6O5/c1-6-29(37)35-21-14-22(27(41-5)16-24(21)36(2)23-9-7-8-10-26(23)40-4)34-28-15-20(32-17-33-28)18-11-12-25(39-3)19(13-18)30(31)38/h6-17H,1H2,2-5H3,(H2,31,38)(H,35,37)(H,32,33,34) |
| InChIKey | LWGWSRMJWVOGTI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.61 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|