C30H39N9O2 — CID 174023433
N-[5-[[6-[2-(3-aminoprop-2-enylideneamino)anilino]pyrimidin-4-yl]amino]-2-[2-(diethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 174023433) has the molecular formula C30H39N9O2 and a molecular weight of 557.70 g/mol. Its IUPAC name is N-[5-[[6-[2-(3-aminoprop-2-enylideneamino)anilino]pyrimidin-4-yl]amino]-2-[2-(diethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[5-[[6-[2-(3-aminoprop-2-enylideneamino)anilino]pyrimidin-4-yl]amino]-2-[2-(diethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 174023433 |
| Molecular Formula | C30H39N9O2 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.32 |
| IUPAC Name | N-[5-[[6-[2-(3-aminoprop-2-enylideneamino)anilino]pyrimidin-4-yl]amino]-2-[2-(diethylamino)ethyl-methylamino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2cc(Nc3ccccc3/N=C/C=CN)ncn2)c(OC)cc1N(C)CCN(CC)CC |
| InChI | InChI=1S/C30H39N9O2/c1-6-30(40)37-24-18-25(27(41-5)19-26(24)38(4)16-17-39(7-2)8-3)36-29-20-28(33-21-34-29)35-23-13-10-9-12-22(23)32-15-11-14-31/h6,9-15,18-21H,1,7-8,16-17,31H2,2-5H3,(H,37,40)(H2,33,34,35,36)/b14-11?,32-15+ |
| InChIKey | HAHUUIXDNGRSKG-YCKYDSFLSA-N |
| XLogP | 5.05 |
| TPSA | 133.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|