C16H17F2N3O2 — CID 56782083
1-[2-(2,4-difluorophenoxy)ethyl]-3-(2-pyridin-3-ylethyl)urea (PubChem CID 56782083) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenoxy)ethyl]-3-(2-pyridin-3-ylethyl)urea.
| Compound Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(2-pyridin-3-ylethyl)urea |
|---|---|
| PubChem CID | 56782083 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 1-[2-(2,4-difluorophenoxy)ethyl]-3-(2-pyridin-3-ylethyl)urea |
| SMILES | O=C(NCCOc1ccc(F)cc1F)NCCc1cccnc1 |
| InChI | InChI=1S/C16H17F2N3O2/c17-13-3-4-15(14(18)10-13)23-9-8-21-16(22)20-7-5-12-2-1-6-19-11-12/h1-4,6,10-11H,5,7-9H2,(H2,20,21,22) |
| InChIKey | LNTVIKOSFSVIHI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|