C17H21N3O4 — CID 112975469
1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(pyridin-3-ylmethyl)urea (PubChem CID 112975469) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(pyridin-3-ylmethyl)urea.
| Compound Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(pyridin-3-ylmethyl)urea |
|---|---|
| PubChem CID | 112975469 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[2-(2,3-dimethoxyphenoxy)ethyl]-3-(pyridin-3-ylmethyl)urea |
| SMILES | COc1cccc(OCCNC(=O)NCc2cccnc2)c1OC |
| InChI | InChI=1S/C17H21N3O4/c1-22-14-6-3-7-15(16(14)23-2)24-10-9-19-17(21)20-12-13-5-4-8-18-11-13/h3-8,11H,9-10,12H2,1-2H3,(H2,19,20,21) |
| InChIKey | PUZVDZPPZMMFAA-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|